C20H22ClN7O2 — CID 171659592
(3S,4E)-4-[5-chloro-4-(6-piperidin-4-ylpyrazolo[1,5-b]pyridazin-3-yl)pyrimidin-2-yl]iminooxan-3-ol (PubChem CID 171659592) has the molecular formula C20H22ClN7O2 and a molecular weight of 427.90 g/mol. Its IUPAC name is (3S,4E)-4-[5-chloro-4-(6-piperidin-4-ylpyrazolo[1,5-b]pyridazin-3-yl)pyrimidin-2-yl]iminooxan-3-ol.
| Compound Name | (3S,4E)-4-[5-chloro-4-(6-piperidin-4-ylpyrazolo[1,5-b]pyridazin-3-yl)pyrimidin-2-yl]iminooxan-3-ol |
|---|---|
| PubChem CID | 171659592 |
| Molecular Formula | C20H22ClN7O2 |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (3S,4E)-4-[5-chloro-4-(6-piperidin-4-ylpyrazolo[1,5-b]pyridazin-3-yl)pyrimidin-2-yl]iminooxan-3-ol |
| SMILES | O[C@@H]1COCC/C1=N\c1ncc(Cl)c(-c2cnn3nc(C4CCNCC4)ccc23)n1 |
| InChI | InChI=1S/C20H22ClN7O2/c21-14-10-23-20(25-16-5-8-30-11-18(16)29)26-19(14)13-9-24-28-17(13)2-1-15(27-28)12-3-6-22-7-4-12/h1-2,9-10,12,18,22,29H,3-8,11H2/b25-16+/t18-/m1/s1 |
| InChIKey | WPWJVGLWHUWZSN-OAKZWBAKSA-N |
| XLogP | 2.16 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|