C24H24ClN9O — CID 171660145
1-[10-[5-chloro-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]-1,4,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]ethanone (PubChem CID 171660145) has the molecular formula C24H24ClN9O and a molecular weight of 489.97 g/mol. Its IUPAC name is 1-[10-[5-chloro-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]-1,4,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]ethanone.
| Compound Name | 1-[10-[5-chloro-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]-1,4,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]ethanone |
|---|---|
| PubChem CID | 171660145 |
| Molecular Formula | C24H24ClN9O |
| Molecular Weight | 489.97 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 1-[10-[5-chloro-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]-1,4,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]ethanone |
| SMILES | CC(=O)N1Cc2ccc3c(-c4nc(Nc5ccc(N6CCNCC6)cn5)ncc4Cl)cnn3c2C1 |
| InChI | InChI=1S/C24H24ClN9O/c1-15(35)33-13-16-2-4-20-18(11-29-34(20)21(16)14-33)23-19(25)12-28-24(31-23)30-22-5-3-17(10-27-22)32-8-6-26-7-9-32/h2-5,10-12,26H,6-9,13-14H2,1H3,(H,27,28,30,31) |
| InChIKey | YEQFLDLHSSLHKL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |