C19H25N7O — CID 10067549
4-(cyclopentylamino)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidine-5-carbaldehyde (PubChem CID 10067549) has the molecular formula C19H25N7O and a molecular weight of 367.46 g/mol. Its IUPAC name is 4-(cyclopentylamino)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-(cyclopentylamino)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 10067549 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 4-(cyclopentylamino)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1cnc(Nc2ccc(N3CCNCC3)cn2)nc1NC1CCCC1 |
| InChI | InChI=1S/C19H25N7O/c27-13-14-11-22-19(25-18(14)23-15-3-1-2-4-15)24-17-6-5-16(12-21-17)26-9-7-20-8-10-26/h5-6,11-13,15,20H,1-4,7-10H2,(H2,21,22,23,24,25) |
| InChIKey | HKDZAONYPKFBBW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|