C24H33N7O4 — CID 87616889
tert-butyl [4-[6-[[4-(cyclopentylamino)-5-formylpyrimidin-2-yl]amino]-3-pyridinyl]piperazin-1-yl] carbonate (PubChem CID 87616889) has the molecular formula C24H33N7O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is tert-butyl [4-[6-[[4-(cyclopentylamino)-5-formylpyrimidin-2-yl]amino]-3-pyridinyl]piperazin-1-yl] carbonate.
| Compound Name | tert-butyl [4-[6-[[4-(cyclopentylamino)-5-formylpyrimidin-2-yl]amino]-3-pyridinyl]piperazin-1-yl] carbonate |
|---|---|
| PubChem CID | 87616889 |
| Molecular Formula | C24H33N7O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | tert-butyl [4-[6-[[4-(cyclopentylamino)-5-formylpyrimidin-2-yl]amino]-3-pyridinyl]piperazin-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CCN(c2ccc(Nc3ncc(C=O)c(NC4CCCC4)n3)nc2)CC1 |
| InChI | InChI=1S/C24H33N7O4/c1-24(2,3)34-23(33)35-31-12-10-30(11-13-31)19-8-9-20(25-15-19)28-22-26-14-17(16-32)21(29-22)27-18-6-4-5-7-18/h8-9,14-16,18H,4-7,10-13H2,1-3H3,(H2,25,26,27,28,29) |
| InChIKey | NDZFMFQVEDZDMZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|