C13H19FN4O2 — CID 171660318
[(3R)-3-(2-amino-5-fluoropyrimidin-4-yl)cyclopentyl] N-propan-2-ylcarbamate (PubChem CID 171660318) has the molecular formula C13H19FN4O2 and a molecular weight of 282.32 g/mol. Its IUPAC name is [(3R)-3-(2-amino-5-fluoropyrimidin-4-yl)cyclopentyl] N-propan-2-ylcarbamate.
| Compound Name | [(3R)-3-(2-amino-5-fluoropyrimidin-4-yl)cyclopentyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 171660318 |
| Molecular Formula | C13H19FN4O2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(3R)-3-(2-amino-5-fluoropyrimidin-4-yl)cyclopentyl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC1CC[C@@H](c2nc(N)ncc2F)C1 |
| InChI | InChI=1S/C13H19FN4O2/c1-7(2)17-13(19)20-9-4-3-8(5-9)11-10(14)6-16-12(15)18-11/h6-9H,3-5H2,1-2H3,(H,17,19)(H2,15,16,18)/t8-,9?/m1/s1 |
| InChIKey | KGDUEBDNKGCUJJ-VEDVMXKPSA-N |
| XLogP | 1.97 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |