C15H17F3N2O3 — CID 171662797
methyl 3-amino-5-[3-(trifluoromethyl)piperidine-1-carbonyl]benzoate (PubChem CID 171662797) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is methyl 3-amino-5-[3-(trifluoromethyl)piperidine-1-carbonyl]benzoate.
| Compound Name | methyl 3-amino-5-[3-(trifluoromethyl)piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 171662797 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl 3-amino-5-[3-(trifluoromethyl)piperidine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1cc(N)cc(C(=O)N2CCCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C15H17F3N2O3/c1-23-14(22)10-5-9(6-12(19)7-10)13(21)20-4-2-3-11(8-20)15(16,17)18/h5-7,11H,2-4,8,19H2,1H3 |
| InChIKey | ULIUFMUHSLZZLJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|