C17H18BrF3N2O — CID 171663023
(7-bromo-1-ethylindol-2-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 171663023) has the molecular formula C17H18BrF3N2O and a molecular weight of 403.24 g/mol. Its IUPAC name is (7-bromo-1-ethylindol-2-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (7-bromo-1-ethylindol-2-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 171663023 |
| Molecular Formula | C17H18BrF3N2O |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (7-bromo-1-ethylindol-2-yl)-[4-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | CCn1c(C(=O)N2CCC(C(F)(F)F)CC2)cc2cccc(Br)c21 |
| InChI | InChI=1S/C17H18BrF3N2O/c1-2-23-14(10-11-4-3-5-13(18)15(11)23)16(24)22-8-6-12(7-9-22)17(19,20)21/h3-5,10,12H,2,6-9H2,1H3 |
| InChIKey | HPOUJWDSAMFHFX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |