C25H40 — CID 171666166
(1R,2Z,7Z,11Z,15S,16S)-1,8,12-trimethyl-4-methylidene-16-propan-2-ylbicyclo[13.3.0]octadeca-2,7,11-triene (PubChem CID 171666166) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (1R,2Z,7Z,11Z,15S,16S)-1,8,12-trimethyl-4-methylidene-16-propan-2-ylbicyclo[13.3.0]octadeca-2,7,11-triene.
| Compound Name | (1R,2Z,7Z,11Z,15S,16S)-1,8,12-trimethyl-4-methylidene-16-propan-2-ylbicyclo[13.3.0]octadeca-2,7,11-triene |
|---|---|
| PubChem CID | 171666166 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (1R,2Z,7Z,11Z,15S,16S)-1,8,12-trimethyl-4-methylidene-16-propan-2-ylbicyclo[13.3.0]octadeca-2,7,11-triene |
| SMILES | C=C1/C=C\[C@@]2(C)CC[C@@H](C(C)C)[C@@H]2CC/C(C)=C\CC/C(C)=C\CC1 |
| InChI | InChI=1S/C25H40/c1-19(2)23-16-18-25(6)17-15-22(5)12-8-10-20(3)9-7-11-21(4)13-14-24(23)25/h10-11,15,17,19,23-24H,5,7-9,12-14,16,18H2,1-4,6H3/b17-15-,20-10-,21-11-/t23-,24-,25-/m0/s1 |
| InChIKey | ZOFLFLLHVFTRDR-LNHQKRKUSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|