C21H28ClN3 — CID 171667242
1-[[1-(4-methylphenyl)cyclopropyl]methyl]-4-(pyridin-4-ylmethyl)piperazine;hydrochloride (PubChem CID 171667242) has the molecular formula C21H28ClN3 and a molecular weight of 357.93 g/mol. Its IUPAC name is 1-[[1-(4-methylphenyl)cyclopropyl]methyl]-4-(pyridin-4-ylmethyl)piperazine;hydrochloride.
| Compound Name | 1-[[1-(4-methylphenyl)cyclopropyl]methyl]-4-(pyridin-4-ylmethyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 171667242 |
| Molecular Formula | C21H28ClN3 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 1-[[1-(4-methylphenyl)cyclopropyl]methyl]-4-(pyridin-4-ylmethyl)piperazine;hydrochloride |
| SMILES | Cc1ccc(C2(CN3CCN(Cc4ccncc4)CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C21H27N3.ClH/c1-18-2-4-20(5-3-18)21(8-9-21)17-24-14-12-23(13-15-24)16-19-6-10-22-11-7-19;/h2-7,10-11H,8-9,12-17H2,1H3;1H |
| InChIKey | YAKHIPVHQAHAMM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |