C16H20ClIN4O2S — CID 171668009
2-[(2-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 171668009) has the molecular formula C16H20ClIN4O2S and a molecular weight of 494.79 g/mol. Its IUPAC name is 2-[(2-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | 2-[(2-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 171668009 |
| Molecular Formula | C16H20ClIN4O2S |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 2-[(2-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | Cc1nc(NC(=O)c2ccccc2Cl)sc1C(=O)NCCN(C)C.I |
| InChI | InChI=1S/C16H19ClN4O2S.HI/c1-10-13(15(23)18-8-9-21(2)3)24-16(19-10)20-14(22)11-6-4-5-7-12(11)17;/h4-7H,8-9H2,1-3H3,(H,18,23)(H,19,20,22);1H |
| InChIKey | INNDXNLBLREPGD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|