C30H41N3O8S — CID 171671618
2-[4-(2,5-dimethylphenyl)-2-methyl-1,3-thiazol-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 171671618) has the molecular formula C30H41N3O8S and a molecular weight of 603.74 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)-2-methyl-1,3-thiazol-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[4-(2,5-dimethylphenyl)-2-methyl-1,3-thiazol-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 171671618 |
| Molecular Formula | C30H41N3O8S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)-2-methyl-1,3-thiazol-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Cc1ccc(C)c(-c2nc(C)sc2CC(=O)N2CCCCC2CN2CCCC2)c1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H33N3OS.C6H8O7/c1-17-9-10-18(2)21(14-17)24-22(29-19(3)25-24)15-23(28)27-13-5-4-8-20(27)16-26-11-6-7-12-26;7-3(8)1-6(13,5(11)12)2-4(9)10/h9-10,14,20H,4-8,11-13,15-16H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | SCNIOQPUAKPCIX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |