C25H34F6N4O7 — CID 171672497
[1'-(oxan-4-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171672497) has the molecular formula C25H34F6N4O7 and a molecular weight of 616.56 g/mol. Its IUPAC name is [1'-(oxan-4-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [1'-(oxan-4-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171672497 |
| Molecular Formula | C25H34F6N4O7 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | [1'-(oxan-4-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(C1Cn2ccnc2C2(CCN(CC3CCOCC3)CC2)O1)N1CCCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H32N4O3.2C2HF3O2/c26-19(24-8-1-2-9-24)18-16-25-12-7-22-20(25)21(28-18)5-10-23(11-6-21)15-17-3-13-27-14-4-17;2*3-2(4,5)1(6)7/h7,12,17-18H,1-6,8-11,13-16H2;2*(H,6,7) |
| InChIKey | WMISCXAOLYGBFE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |