C24H28F4N4O4 — CID 155851979
N-(cyclopropylmethyl)-1'-[(4-fluorophenyl)methyl]spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155851979) has the molecular formula C24H28F4N4O4 and a molecular weight of 512.50 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1'-[(4-fluorophenyl)methyl]spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(cyclopropylmethyl)-1'-[(4-fluorophenyl)methyl]spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851979 |
| Molecular Formula | C24H28F4N4O4 |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-(cyclopropylmethyl)-1'-[(4-fluorophenyl)methyl]spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC1CC1)C1Cn2ccnc2C2(CCN(Cc3ccc(F)cc3)CC2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27FN4O2.C2HF3O2/c23-18-5-3-17(4-6-18)14-26-10-7-22(8-11-26)21-24-9-12-27(21)15-19(29-22)20(28)25-13-16-1-2-16;3-2(4,5)1(6)7/h3-6,9,12,16,19H,1-2,7-8,10-11,13-15H2,(H,25,28);(H,6,7) |
| InChIKey | HHJPOEZVASIRQW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |