C23H25F7N4O6 — CID 155838211
1'-[(4-fluorophenyl)methyl]-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155838211) has the molecular formula C23H25F7N4O6 and a molecular weight of 586.46 g/mol. Its IUPAC name is 1'-[(4-fluorophenyl)methyl]-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1'-[(4-fluorophenyl)methyl]-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155838211 |
| Molecular Formula | C23H25F7N4O6 |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 1'-[(4-fluorophenyl)methyl]-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CNC(=O)C1Cn2ccnc2C2(CCN(Cc3ccc(F)cc3)CC2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23FN4O2.2C2HF3O2/c1-21-17(25)16-13-24-11-8-22-18(24)19(26-16)6-9-23(10-7-19)12-14-2-4-15(20)5-3-14;2*3-2(4,5)1(6)7/h2-5,8,11,16H,6-7,9-10,12-13H2,1H3,(H,21,25);2*(H,6,7) |
| InChIKey | RIXQLIJXODMISD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |