C24H30F6N4O7 — CID 155865459
N,N-diethyl-1'-(furan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155865459) has the molecular formula C24H30F6N4O7 and a molecular weight of 600.51 g/mol. Its IUPAC name is N,N-diethyl-1'-(furan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-diethyl-1'-(furan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155865459 |
| Molecular Formula | C24H30F6N4O7 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | N,N-diethyl-1'-(furan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN(CC)C(=O)C1Cn2ccnc2C2(CCN(Cc3ccco3)CC2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N4O3.2C2HF3O2/c1-3-23(4-2)18(25)17-15-24-12-9-21-19(24)20(27-17)7-10-22(11-8-20)14-16-6-5-13-26-16;2*3-2(4,5)1(6)7/h5-6,9,12-13,17H,3-4,7-8,10-11,14-15H2,1-2H3;2*(H,6,7) |
| InChIKey | RNLVVYNQCXAADR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |