C22H30N4O4S — CID 97440417
(6R)-N,N-diethyl-1'-(3-methylphenyl)sulfonylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide (PubChem CID 97440417) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is (6R)-N,N-diethyl-1'-(3-methylphenyl)sulfonylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide.
| Compound Name | (6R)-N,N-diethyl-1'-(3-methylphenyl)sulfonylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
|---|---|
| PubChem CID | 97440417 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (6R)-N,N-diethyl-1'-(3-methylphenyl)sulfonylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1Cn2ccnc2C2(CCN(S(=O)(=O)c3cccc(C)c3)CC2)O1 |
| InChI | InChI=1S/C22H30N4O4S/c1-4-24(5-2)20(27)19-16-25-14-11-23-21(25)22(30-19)9-12-26(13-10-22)31(28,29)18-8-6-7-17(3)15-18/h6-8,11,14-15,19H,4-5,9-10,12-13,16H2,1-3H3/t19-/m1/s1 |
| InChIKey | IVPOVZKWWHGHED-LJQANCHMSA-N |
| XLogP | 2.14 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |