C23H29F3N4O6 — CID 155837859
N,N-diethyl-1'-(2-methylfuran-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155837859) has the molecular formula C23H29F3N4O6 and a molecular weight of 514.50 g/mol. Its IUPAC name is N,N-diethyl-1'-(2-methylfuran-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-diethyl-1'-(2-methylfuran-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837859 |
| Molecular Formula | C23H29F3N4O6 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N,N-diethyl-1'-(2-methylfuran-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)C(=O)C1Cn2ccnc2C2(CCN(C(=O)c3ccoc3C)CC2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28N4O4.C2HF3O2/c1-4-23(5-2)19(27)17-14-25-12-9-22-20(25)21(29-17)7-10-24(11-8-21)18(26)16-6-13-28-15(16)3;3-2(4,5)1(6)7/h6,9,12-13,17H,4-5,7-8,10-11,14H2,1-3H3;(H,6,7) |
| InChIKey | LUJSBAQKPJYNIT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |