C20H26N4O3S — CID 97360912
(6R)-N,N-diethyl-1'-(thiophene-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide (PubChem CID 97360912) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is (6R)-N,N-diethyl-1'-(thiophene-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide.
| Compound Name | (6R)-N,N-diethyl-1'-(thiophene-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
|---|---|
| PubChem CID | 97360912 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (6R)-N,N-diethyl-1'-(thiophene-3-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1Cn2ccnc2C2(CCN(C(=O)c3ccsc3)CC2)O1 |
| InChI | InChI=1S/C20H26N4O3S/c1-3-22(4-2)18(26)16-13-24-11-8-21-19(24)20(27-16)6-9-23(10-7-20)17(25)15-5-12-28-14-15/h5,8,11-12,14,16H,3-4,6-7,9-10,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | UETLFLOCUDGMHY-MRXNPFEDSA-N |
| XLogP | 2.34 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |