C20H28N4O2S — CID 97360886
(6R)-N,N-diethyl-1'-(thiophen-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide (PubChem CID 97360886) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is (6R)-N,N-diethyl-1'-(thiophen-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide.
| Compound Name | (6R)-N,N-diethyl-1'-(thiophen-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
|---|---|
| PubChem CID | 97360886 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (6R)-N,N-diethyl-1'-(thiophen-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1Cn2ccnc2C2(CCN(Cc3cccs3)CC2)O1 |
| InChI | InChI=1S/C20H28N4O2S/c1-3-23(4-2)18(25)17-15-24-12-9-21-19(24)20(26-17)7-10-22(11-8-20)14-16-6-5-13-27-16/h5-6,9,12-13,17H,3-4,7-8,10-11,14-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | NUORIVCPNGOENW-QGZVFWFLSA-N |
| XLogP | 2.70 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |