C24H22N6O2 — CID 171674434
[(3aR,6aS)-4-(3-phenyl-1H-pyrazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(3H-benzimidazol-5-yl)methanone (PubChem CID 171674434) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is [(3aR,6aS)-4-(3-phenyl-1H-pyrazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(3H-benzimidazol-5-yl)methanone.
| Compound Name | [(3aR,6aS)-4-(3-phenyl-1H-pyrazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 171674434 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [(3aR,6aS)-4-(3-phenyl-1H-pyrazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(3H-benzimidazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)n[nH]1)N1CC[C@H]2[C@H]1CCN2C(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C24H22N6O2/c31-23(16-6-7-17-19(12-16)26-14-25-17)29-10-8-22-21(29)9-11-30(22)24(32)20-13-18(27-28-20)15-4-2-1-3-5-15/h1-7,12-14,21-22H,8-11H2,(H,25,26)(H,27,28)/t21-,22+/m0/s1 |
| InChIKey | BCCUPKIKGGDQJZ-FCHUYYIVSA-N |
| XLogP | 3.08 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |