C15H21F3N2O3 — CID 171675092
(1S,2R,3S,4R)-N-cyclopropyl-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171675092) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is (1S,2R,3S,4R)-N-cyclopropyl-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,3S,4R)-N-cyclopropyl-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171675092 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (1S,2R,3S,4R)-N-cyclopropyl-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(O)(C(=O)N[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)NC1CC1)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O3/c1-14(23,15(16,17)18)13(22)20-11-8-3-2-7(6-8)10(11)12(21)19-9-4-5-9/h7-11,23H,2-6H2,1H3,(H,19,21)(H,20,22)/t7-,8+,10+,11-,14?/m0/s1 |
| InChIKey | UQULVTOPSXSAED-CIAVSIPGSA-N |
| XLogP | 1.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |