About N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide
N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 171675390) has the molecular formula C20H18Cl2N2O2
and a molecular weight of 389.28 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 171675390 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | CCN(Cc1ccc(Cl)cc1Cl)C(=O)c1c(C)noc1-c1ccccc1 |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-3-24(12-15-9-10-16(21)11-17(15)22)20(25)18-13(2)23-26-19(18)14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3 |
| InChIKey | VMKRDCDJGQNEKF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide (CID 171675390) is N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide is CCN(Cc1ccc(Cl)cc1Cl)C(=O)c1c(C)noc1-c1ccccc1.
What is the InChIKey of N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide?
The InChIKey is VMKRDCDJGQNEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N2O2/c1-3-24(12-15-9-10-16(21)11-17(15)22)20(25)18-13(2)23-26-19(18)14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3.
What are the key properties of N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide?
N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide has a molecular weight of 389.28 g/mol, XLogP of 5.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dichlorophenyl)methyl]-N-ethyl-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 171675390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).