C22H36N4O4 — CID 171675830
1-[1-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]piperidine-4-carbonyl]azetidine-3-carboxamide (PubChem CID 171675830) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[1-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]piperidine-4-carbonyl]azetidine-3-carboxamide.
| Compound Name | 1-[1-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]piperidine-4-carbonyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 171675830 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1-[1-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]piperidine-4-carbonyl]azetidine-3-carboxamide |
| SMILES | NC(=O)C1CN(C(=O)C2CCN(C3CCN(C(=O)CC4CCOCC4)CC3)CC2)C1 |
| InChI | InChI=1S/C22H36N4O4/c23-21(28)18-14-26(15-18)22(29)17-1-7-24(8-2-17)19-3-9-25(10-4-19)20(27)13-16-5-11-30-12-6-16/h16-19H,1-15H2,(H2,23,28) |
| InChIKey | KQTDOMIRJPCVDV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |