C19H33N3O3 — CID 42693440
1-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]butan-1-one (PubChem CID 42693440) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]butan-1-one.
| Compound Name | 1-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 42693440 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 1-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCC(N2CCC(C(=O)N3CCOCC3)CC2)CC1 |
| InChI | InChI=1S/C19H33N3O3/c1-2-3-18(23)21-10-6-17(7-11-21)20-8-4-16(5-9-20)19(24)22-12-14-25-15-13-22/h16-17H,2-15H2,1H3 |
| InChIKey | YIJRRTZIWRQYEA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |