C24H22FN5O4 — CID 171677895
N-[1-[4-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]phenyl]cyclobutyl]-5-fluoro-1H-indole-2-carboxamide (PubChem CID 171677895) has the molecular formula C24H22FN5O4 and a molecular weight of 463.47 g/mol. Its IUPAC name is N-[1-[4-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]phenyl]cyclobutyl]-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[1-[4-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]phenyl]cyclobutyl]-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 171677895 |
| Molecular Formula | C24H22FN5O4 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[1-[4-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]amino]phenyl]cyclobutyl]-5-fluoro-1H-indole-2-carboxamide |
| SMILES | O=C(CC1NC(=O)NC1=O)Nc1ccc(C2(NC(=O)c3cc4cc(F)ccc4[nH]3)CCC2)cc1 |
| InChI | InChI=1S/C24H22FN5O4/c25-15-4-7-17-13(10-15)11-18(27-17)22(33)30-24(8-1-9-24)14-2-5-16(6-3-14)26-20(31)12-19-21(32)29-23(34)28-19/h2-7,10-11,19,27H,1,8-9,12H2,(H,26,31)(H,30,33)(H2,28,29,32,34) |
| InChIKey | UFEAWJKESPCUTL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|