C31H32F3N3O3 — CID 171678188
[(3aS,8aR)-2-[3-(dimethylamino)benzoyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-[4-[4-(trifluoromethyl)phenoxy]phenyl]methanone (PubChem CID 171678188) has the molecular formula C31H32F3N3O3 and a molecular weight of 551.61 g/mol. Its IUPAC name is [(3aS,8aR)-2-[3-(dimethylamino)benzoyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-[4-[4-(trifluoromethyl)phenoxy]phenyl]methanone.
| Compound Name | [(3aS,8aR)-2-[3-(dimethylamino)benzoyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-[4-[4-(trifluoromethyl)phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 171678188 |
| Molecular Formula | C31H32F3N3O3 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | [(3aS,8aR)-2-[3-(dimethylamino)benzoyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-[4-[4-(trifluoromethyl)phenoxy]phenyl]methanone |
| SMILES | CN(C)c1cccc(C(=O)N2C[C@H]3CCN(C(=O)c4ccc(Oc5ccc(C(F)(F)F)cc5)cc4)CC[C@H]3C2)c1 |
| InChI | InChI=1S/C31H32F3N3O3/c1-35(2)26-5-3-4-22(18-26)30(39)37-19-23-14-16-36(17-15-24(23)20-37)29(38)21-6-10-27(11-7-21)40-28-12-8-25(9-13-28)31(32,33)34/h3-13,18,23-24H,14-17,19-20H2,1-2H3/t23-,24+ |
| InChIKey | HWXAIVDVIKNODZ-PSWAGMNNSA-N |
| XLogP | 6.19 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |