C17H25N3O — CID 43596235
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(dimethylamino)phenyl]methanone (PubChem CID 43596235) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(dimethylamino)phenyl]methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 43596235 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(dimethylamino)phenyl]methanone |
| SMILES | CN(C)c1cccc(C(=O)N2C[C@H]3CCC(N)C[C@H]3C2)c1 |
| InChI | InChI=1S/C17H25N3O/c1-19(2)16-5-3-4-12(9-16)17(21)20-10-13-6-7-15(18)8-14(13)11-20/h3-5,9,13-15H,6-8,10-11,18H2,1-2H3/t13-,14+,15?/m1/s1 |
| InChIKey | LBVMIJINQRAQNZ-GNXJLENFSA-N |
| XLogP | 1.95 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |