C17H24N2O — CID 43596222
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-ethylphenyl)methanone (PubChem CID 43596222) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-ethylphenyl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 43596222 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)N2C[C@H]3CCC(N)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-2-12-3-5-13(6-4-12)17(20)19-10-14-7-8-16(18)9-15(14)11-19/h3-6,14-16H,2,7-11,18H2,1H3/t14-,15+,16?/m1/s1 |
| InChIKey | OWPYGLNQHINZFO-YSPPHNQVSA-N |
| XLogP | 2.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |