C15H24N4O — CID 66120757
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-1-methylpyrazol-5-yl)methanone (PubChem CID 66120757) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-1-methylpyrazol-5-yl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-1-methylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 66120757 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-1-methylpyrazol-5-yl)methanone |
| SMILES | CCc1cc(C(=O)N2C[C@H]3CCC(N)C[C@H]3C2)n(C)n1 |
| InChI | InChI=1S/C15H24N4O/c1-3-13-7-14(18(2)17-13)15(20)19-8-10-4-5-12(16)6-11(10)9-19/h7,10-12H,3-6,8-9,16H2,1-2H3/t10-,11+,12?/m1/s1 |
| InChIKey | JHFIENOGGMLDOY-UBNQGINQSA-N |
| XLogP | 1.18 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |