C10H12ClN3O4S — CID 171678631
N-[(1-aminocyclopropyl)methyl]-2-chloro-4-nitrobenzenesulfonamide (PubChem CID 171678631) has the molecular formula C10H12ClN3O4S and a molecular weight of 305.74 g/mol. Its IUPAC name is N-[(1-aminocyclopropyl)methyl]-2-chloro-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1-aminocyclopropyl)methyl]-2-chloro-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 171678631 |
| Molecular Formula | C10H12ClN3O4S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N-[(1-aminocyclopropyl)methyl]-2-chloro-4-nitrobenzenesulfonamide |
| SMILES | NC1(CNS(=O)(=O)c2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C10H12ClN3O4S/c11-8-5-7(14(15)16)1-2-9(8)19(17,18)13-6-10(12)3-4-10/h1-2,5,13H,3-4,6,12H2 |
| InChIKey | ALTNOJNZEJCKER-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|