C15H17F6N3O5 — CID 171678725
N-(2-aminoethyl)-2-nitro-N-propan-2-yl-4-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 171678725) has the molecular formula C15H17F6N3O5 and a molecular weight of 433.31 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-nitro-N-propan-2-yl-4-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2-aminoethyl)-2-nitro-N-propan-2-yl-4-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171678725 |
| Molecular Formula | C15H17F6N3O5 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-(2-aminoethyl)-2-nitro-N-propan-2-yl-4-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)N(CCN)C(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O3.C2HF3O2/c1-8(2)18(6-5-17)12(20)10-4-3-9(13(14,15)16)7-11(10)19(21)22;3-2(4,5)1(6)7/h3-4,7-8H,5-6,17H2,1-2H3;(H,6,7) |
| InChIKey | FONMSIXEZJIYBG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|