C15H20N4O2 — CID 171678869
6-(aminomethyl)-N-[1-(3-aminophenyl)ethyl]pyridin-2-amine;formic acid (PubChem CID 171678869) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-(aminomethyl)-N-[1-(3-aminophenyl)ethyl]pyridin-2-amine;formic acid.
| Compound Name | 6-(aminomethyl)-N-[1-(3-aminophenyl)ethyl]pyridin-2-amine;formic acid |
|---|---|
| PubChem CID | 171678869 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-(aminomethyl)-N-[1-(3-aminophenyl)ethyl]pyridin-2-amine;formic acid |
| SMILES | CC(Nc1cccc(CN)n1)c1cccc(N)c1.O=CO |
| InChI | InChI=1S/C14H18N4.CH2O2/c1-10(11-4-2-5-12(16)8-11)17-14-7-3-6-13(9-15)18-14;2-1-3/h2-8,10H,9,15-16H2,1H3,(H,17,18);1H,(H,2,3) |
| InChIKey | BKGLJRZJNXHENX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|