C12H11N5 — CID 171679371
N-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-b]pyrazin-2-amine (PubChem CID 171679371) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-b]pyrazin-2-amine.
| Compound Name | N-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-b]pyrazin-2-amine |
|---|---|
| PubChem CID | 171679371 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-b]pyrazin-2-amine |
| SMILES | c1ccc(CNc2cnc3[nH]ccc3n2)nc1 |
| InChI | InChI=1S/C12H11N5/c1-2-5-13-9(3-1)7-15-11-8-16-12-10(17-11)4-6-14-12/h1-6,8H,7H2,(H,14,16)(H,15,17) |
| InChIKey | LBSHVVOCUXCKDP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |