C10H11N5 — CID 80777882
4-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 80777882) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80777882 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nccc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C10H11N5/c11-10-13-6-4-9(15-10)14-7-8-3-1-2-5-12-8/h1-6H,7H2,(H3,11,13,14,15) |
| InChIKey | HJSQOEHOAVZABW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |