C13H18N6 — CID 80777060
6-N-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-2,4,6-triamine (PubChem CID 80777060) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 6-N-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80777060 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 6-N-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-2,4,6-triamine |
| SMILES | CCCNc1cc(NCc2ccccn2)nc(N)n1 |
| InChI | InChI=1S/C13H18N6/c1-2-6-16-11-8-12(19-13(14)18-11)17-9-10-5-3-4-7-15-10/h3-5,7-8H,2,6,9H2,1H3,(H4,14,16,17,18,19) |
| InChIKey | QLLYBOZIUFNWLK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |