C13H18N6 — CID 80946582
6-hydrazinyl-2-propyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 80946582) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 6-hydrazinyl-2-propyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-propyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80946582 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 6-hydrazinyl-2-propyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | CCCc1nc(NN)cc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C13H18N6/c1-2-5-11-17-12(8-13(18-11)19-14)16-9-10-6-3-4-7-15-10/h3-4,6-8H,2,5,9,14H2,1H3,(H2,16,17,18,19) |
| InChIKey | OWJGOVLNIZQKBH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|