C15H21N5O — CID 82456039
6-ethoxy-2-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,5-diamine (PubChem CID 82456039) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 6-ethoxy-2-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-ethoxy-2-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82456039 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 6-ethoxy-2-propyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,5-diamine |
| SMILES | CCCc1nc(NCc2ccccn2)c(N)c(OCC)n1 |
| InChI | InChI=1S/C15H21N5O/c1-3-7-12-19-14(13(16)15(20-12)21-4-2)18-10-11-8-5-6-9-17-11/h5-6,8-9H,3-4,7,10,16H2,1-2H3,(H,18,19,20) |
| InChIKey | ZWFRDVQWYYOVOJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |