C20H16FN3 — CID 171679896
4-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methyl]aniline (PubChem CID 171679896) has the molecular formula C20H16FN3 and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methyl]aniline.
| Compound Name | 4-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 171679896 |
| Molecular Formula | C20H16FN3 |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methyl]aniline |
| SMILES | Fc1cccc(CNc2ccc(-c3nc4ccccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C20H16FN3/c21-16-5-3-4-14(12-16)13-22-17-10-8-15(9-11-17)20-23-18-6-1-2-7-19(18)24-20/h1-12,22H,13H2,(H,23,24) |
| InChIKey | UGJCKWSOXJETBI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |