C17H17N3O4S — CID 171680204
5-(2-naphthalen-2-ylacetyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one (PubChem CID 171680204) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 5-(2-naphthalen-2-ylacetyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one.
| Compound Name | 5-(2-naphthalen-2-ylacetyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 171680204 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 5-(2-naphthalen-2-ylacetyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
| SMILES | O=C1NS(=O)(=O)N2CCN(C(=O)Cc3ccc4ccccc4c3)CC12 |
| InChI | InChI=1S/C17H17N3O4S/c21-16(10-12-5-6-13-3-1-2-4-14(13)9-12)19-7-8-20-15(11-19)17(22)18-25(20,23)24/h1-6,9,15H,7-8,10-11H2,(H,18,22) |
| InChIKey | CGAOGDGXNCIVCD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |