C16H14FN3O4S — CID 171680208
5-(4-fluoronaphthalene-1-carbonyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one (PubChem CID 171680208) has the molecular formula C16H14FN3O4S and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-(4-fluoronaphthalene-1-carbonyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one.
| Compound Name | 5-(4-fluoronaphthalene-1-carbonyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 171680208 |
| Molecular Formula | C16H14FN3O4S |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 5-(4-fluoronaphthalene-1-carbonyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
| SMILES | O=C1NS(=O)(=O)N2CCN(C(=O)c3ccc(F)c4ccccc34)CC12 |
| InChI | InChI=1S/C16H14FN3O4S/c17-13-6-5-12(10-3-1-2-4-11(10)13)16(22)19-7-8-20-14(9-19)15(21)18-25(20,23)24/h1-6,14H,7-9H2,(H,18,21) |
| InChIKey | YQVDRJMBLPNYFR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |