C12H10Cl2FN3O4S — CID 171680182
5-(2,4-dichloro-5-fluorobenzoyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one (PubChem CID 171680182) has the molecular formula C12H10Cl2FN3O4S and a molecular weight of 382.20 g/mol. Its IUPAC name is 5-(2,4-dichloro-5-fluorobenzoyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one.
| Compound Name | 5-(2,4-dichloro-5-fluorobenzoyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 171680182 |
| Molecular Formula | C12H10Cl2FN3O4S |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 5-(2,4-dichloro-5-fluorobenzoyl)-1,1-dioxo-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
| SMILES | O=C1NS(=O)(=O)N2CCN(C(=O)c3cc(F)c(Cl)cc3Cl)CC12 |
| InChI | InChI=1S/C12H10Cl2FN3O4S/c13-7-4-8(14)9(15)3-6(7)12(20)17-1-2-18-10(5-17)11(19)16-23(18,21)22/h3-4,10H,1-2,5H2,(H,16,19) |
| InChIKey | OXOVWLAREZXHMN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|