C18H22N2O3 — CID 171680757
1-benzofuran-3-yl-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 171680757) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-benzofuran-3-yl-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | 1-benzofuran-3-yl-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171680757 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-benzofuran-3-yl-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1coc2ccccc12)N1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C18H22N2O3/c21-18(16-13-23-17-6-2-1-5-15(16)17)20-9-7-19(8-10-20)12-14-4-3-11-22-14/h1-2,5-6,13-14H,3-4,7-12H2 |
| InChIKey | KIZOTLQNYVHJLM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |