C23H28N2O2 — CID 55337903
1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-2,2-diphenylethanone (PubChem CID 55337903) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 55337903 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C23H28N2O2/c26-23(25-15-13-24(14-16-25)18-21-12-7-17-27-21)22(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,21-22H,7,12-18H2 |
| InChIKey | IIGBWNCBRHVWPG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |