C17H26N2O2 — CID 94767855
(1S)-2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-1-phenylethanol (PubChem CID 94767855) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (1S)-2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-1-phenylethanol.
| Compound Name | (1S)-2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 94767855 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (1S)-2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-1-phenylethanol |
| SMILES | O[C@H](CN1CCN(C[C@H]2CCCO2)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c20-17(15-5-2-1-3-6-15)14-19-10-8-18(9-11-19)13-16-7-4-12-21-16/h1-3,5-6,16-17,20H,4,7-14H2/t16-,17-/m1/s1 |
| InChIKey | LNHRKKUHWVJJDK-IAGOWNOFSA-N |
| XLogP | 1.52 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |