C27H44N4O — CID 51001056
1-(oxolan-2-ylmethyl)-4-[1-phenyl-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]piperazine (PubChem CID 51001056) has the molecular formula C27H44N4O and a molecular weight of 440.68 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-4-[1-phenyl-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]piperazine.
| Compound Name | 1-(oxolan-2-ylmethyl)-4-[1-phenyl-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 51001056 |
| Molecular Formula | C27H44N4O |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-4-[1-phenyl-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]piperazine |
| SMILES | c1ccc(C(CN2CCC(N3CCCCC3)CC2)N2CCN(CC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C27H44N4O/c1-3-8-24(9-4-1)27(31-19-17-29(18-20-31)22-26-10-7-21-32-26)23-28-15-11-25(12-16-28)30-13-5-2-6-14-30/h1,3-4,8-9,25-27H,2,5-7,10-23H2 |
| InChIKey | VLQWBBAISJOUST-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |