C15H21N3O4 — CID 171682287
methyl 3-cyclohexyl-3-[(6-oxo-1H-pyridazine-4-carbonyl)amino]propanoate (PubChem CID 171682287) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 3-cyclohexyl-3-[(6-oxo-1H-pyridazine-4-carbonyl)amino]propanoate.
| Compound Name | methyl 3-cyclohexyl-3-[(6-oxo-1H-pyridazine-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 171682287 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | methyl 3-cyclohexyl-3-[(6-oxo-1H-pyridazine-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cn[nH]c(=O)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H21N3O4/c1-22-14(20)8-12(10-5-3-2-4-6-10)17-15(21)11-7-13(19)18-16-9-11/h7,9-10,12H,2-6,8H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | ABJIJUJRNXOFFW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |