C28H27F3N4O3 — CID 171683936
N'-(2,6-dimethylphenyl)-N-[4-[1-[2-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]phenyl]oxamide (PubChem CID 171683936) has the molecular formula C28H27F3N4O3 and a molecular weight of 524.54 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-[4-[1-[2-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]phenyl]oxamide.
| Compound Name | N'-(2,6-dimethylphenyl)-N-[4-[1-[2-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]phenyl]oxamide |
|---|---|
| PubChem CID | 171683936 |
| Molecular Formula | C28H27F3N4O3 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-[4-[1-[2-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]phenyl]oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)Nc1ccc(C2CCN(C(=O)c3ccnc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C28H27F3N4O3/c1-17-4-3-5-18(2)24(17)34-26(37)25(36)33-22-8-6-19(7-9-22)20-11-14-35(15-12-20)27(38)21-10-13-32-23(16-21)28(29,30)31/h3-10,13,16,20H,11-12,14-15H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | DZBCXGXPTAEFAB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|