C30H26N4O4 — CID 171683987
N-[1-[1-(1-benzofuran-6-carbonyl)piperidin-4-yl]pyrazol-4-yl]-4-phenoxybenzamide (PubChem CID 171683987) has the molecular formula C30H26N4O4 and a molecular weight of 506.56 g/mol. Its IUPAC name is N-[1-[1-(1-benzofuran-6-carbonyl)piperidin-4-yl]pyrazol-4-yl]-4-phenoxybenzamide.
| Compound Name | N-[1-[1-(1-benzofuran-6-carbonyl)piperidin-4-yl]pyrazol-4-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 171683987 |
| Molecular Formula | C30H26N4O4 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[1-[1-(1-benzofuran-6-carbonyl)piperidin-4-yl]pyrazol-4-yl]-4-phenoxybenzamide |
| SMILES | O=C(Nc1cnn(C2CCN(C(=O)c3ccc4ccoc4c3)CC2)c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N4O4/c35-29(22-8-10-27(11-9-22)38-26-4-2-1-3-5-26)32-24-19-31-34(20-24)25-12-15-33(16-13-25)30(36)23-7-6-21-14-17-37-28(21)18-23/h1-11,14,17-20,25H,12-13,15-16H2,(H,32,35) |
| InChIKey | YPHGJNZWNFVXLU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |