C29H28Cl2FN3O3S — CID 171684226
(2-benzylsulfanyl-3-pyridinyl)-[9-(3,5-dichloro-4-fluorobenzoyl)-5-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl]methanone (PubChem CID 171684226) has the molecular formula C29H28Cl2FN3O3S and a molecular weight of 588.53 g/mol. Its IUPAC name is (2-benzylsulfanyl-3-pyridinyl)-[9-(3,5-dichloro-4-fluorobenzoyl)-5-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl]methanone.
| Compound Name | (2-benzylsulfanyl-3-pyridinyl)-[9-(3,5-dichloro-4-fluorobenzoyl)-5-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl]methanone |
|---|---|
| PubChem CID | 171684226 |
| Molecular Formula | C29H28Cl2FN3O3S |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | (2-benzylsulfanyl-3-pyridinyl)-[9-(3,5-dichloro-4-fluorobenzoyl)-5-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl]methanone |
| SMILES | O=C(c1cc(Cl)c(F)c(Cl)c1)N1CCC2(CC1)CN(C(=O)c1cccnc1SCc1ccccc1)CCC2O |
| InChI | InChI=1S/C29H28Cl2FN3O3S/c30-22-15-20(16-23(31)25(22)32)27(37)34-13-9-29(10-14-34)18-35(12-8-24(29)36)28(38)21-7-4-11-33-26(21)39-17-19-5-2-1-3-6-19/h1-7,11,15-16,24,36H,8-10,12-14,17-18H2 |
| InChIKey | FURLWKPTPMSCFH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|