C29H32F3N3O3 — CID 171685176
(E)-1-[(3aS,6aS)-5-(1-benzylpiperidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 171685176) has the molecular formula C29H32F3N3O3 and a molecular weight of 527.59 g/mol. Its IUPAC name is (E)-1-[(3aS,6aS)-5-(1-benzylpiperidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[(3aS,6aS)-5-(1-benzylpiperidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171685176 |
| Molecular Formula | C29H32F3N3O3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | (E)-1-[(3aS,6aS)-5-(1-benzylpiperidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(C1CCCN(Cc2ccccc2)C1)N1C[C@@H]2CCN(C(=O)/C=C/c3ccc(OC(F)(F)F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C29H32F3N3O3/c30-29(31,32)38-25-11-8-21(9-12-25)10-13-27(36)35-16-14-23-19-34(20-26(23)35)28(37)24-7-4-15-33(18-24)17-22-5-2-1-3-6-22/h1-3,5-6,8-13,23-24,26H,4,7,14-20H2/b13-10+/t23-,24?,26+/m0/s1 |
| InChIKey | ZWJIXBONYQNAKE-HJWXOWMVSA-N |
| XLogP | 4.57 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|